40127-89-7 Usage
Description
3-AMINO-6-(CHLOROMETHYL)-2-PYRAZINECARBONITRILE 4-OXIDE is an organic compound characterized by its unique molecular structure, which features a pyrazine core with a nitrogen atom at the 3rd position, a chloromethyl group at the 6th position, and a cyano group at the 2nd position. The 4-oxide functional group adds an extra layer of reactivity and potential applications in various chemical processes.
Uses
Used in Chemical Synthesis Studies:
3-AMINO-6-(CHLOROMETHYL)-2-PYRAZINECARBONITRILE 4-OXIDE is used as a key intermediate in the synthesis of various organic compounds. Its unique structure allows for further functionalization and modification, making it a valuable building block in the development of new molecules with potential applications in pharmaceuticals, materials science, and other fields.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 3-AMINO-6-(CHLOROMETHYL)-2-PYRAZINECARBONITRILE 4-OXIDE is used as a starting material for the development of new drugs. Its versatile chemical properties enable the creation of novel drug candidates with potential therapeutic benefits.
Used in Materials Science:
3-AMINO-6-(CHLOROMETHYL)-2-PYRAZINECARBONITRILE 4-OXIDE can also be utilized in the field of materials science, where it may contribute to the development of new materials with specific properties, such as improved stability, reactivity, or selectivity in various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 40127-89-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,0,1,2 and 7 respectively; the second part has 2 digits, 8 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 40127-89:
(7*4)+(6*0)+(5*1)+(4*2)+(3*7)+(2*8)+(1*9)=87
87 % 10 = 7
So 40127-89-7 is a valid CAS Registry Number.
InChI:InChI=1/C6H5ClN4O/c7-1-4-3-11(12)6(9)5(2-8)10-4/h3H,1,9H2
