4021-08-3 Usage
Description
4-METHYL-PYRIDINE-2-CARBOXYLIC ACID, also known as 4-Methylpicolinic acid, is an organic compound with the chemical formula C6H6NO2. It is a white to light brown solid and is characterized by its unique chemical structure, which includes a pyridine ring with a methyl group at the 4th position and a carboxylic acid group at the 2nd position. 4-METHYL-PYRIDINE-2-CARBOXYLIC ACID has been found to possess various properties that make it useful in different applications.
Uses
Used in Pharmaceutical Industry:
4-METHYL-PYRIDINE-2-CARBOXYLIC ACID is used as an intermediate in the synthesis of various pharmaceutical compounds for its potential neuroprotective properties. It is particularly utilized in the mutasynthesis of potential neuroprotectant derivatives of the bipyridyl collismycin A, which can be beneficial in the development of treatments for neurological disorders.
Used in Chemical Research:
4-METHYL-PYRIDINE-2-CARBOXYLIC ACID serves as a valuable compound in chemical research, particularly in the study of pyridine-based structures and their potential applications. Its unique chemical properties make it an interesting subject for further investigation and development of new compounds with various applications.
Used in Material Science:
Due to its chemical structure, 4-METHYL-PYRIDINE-2-CARBOXYLIC ACID can be used in the development of new materials with specific properties. Its potential applications in material science include the creation of novel polymers, coatings, or other materials with tailored characteristics for use in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 4021-08-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 4,0,2 and 1 respectively; the second part has 2 digits, 0 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 4021-08:
(6*4)+(5*0)+(4*2)+(3*1)+(2*0)+(1*8)=43
43 % 10 = 3
So 4021-08-3 is a valid CAS Registry Number.
InChI:InChI=1/C7H7NO2/c1-5-2-3-8-6(4-5)7(9)10/h2-4H,1H3,(H,9,10)
