40381-91-7 Usage
Description
2,4,6-Trichloronicotinonitrile is an organic compound that serves as a crucial building block in the chemical synthesis and polymerization process. It is characterized by its molecular structure, which includes three chlorine atoms and a nitrile group, making it a versatile compound for various applications.
Uses
Used in Chemical Synthesis:
2,4,6-Trichloronicotinonitrile is used as a building block for the synthesis of various chemicals. Its unique structure allows it to be a key component in the creation of a wide range of compounds, contributing to its versatility in the chemical industry.
Used in Polymerization of Cyanoacetyl Chloride:
In the polymer industry, 2,4,6-trichloronicotinonitrile is utilized as a building block for the polymerization of cyanoacetyl chloride. This process results in the formation of polymers with specific properties, such as increased strength and durability, which can be applied in various industrial applications.
Used in Pharmaceutical Industry:
2,4,6-Trichloronicotinonitrile is also used as an intermediate in the synthesis of certain pharmaceutical compounds. Its role in the development of new drugs highlights its importance in the pharmaceutical sector, as it contributes to the creation of potentially life-saving medications.
Used in Agrochemical Industry:
In the agrochemical industry, 2,4,6-trichloronicotinonitrile is employed as a starting material for the synthesis of various agrochemicals, such as pesticides and herbicides. Its use in this industry helps to develop more effective and environmentally friendly solutions for agricultural challenges.
Check Digit Verification of cas no
The CAS Registry Mumber 40381-91-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,0,3,8 and 1 respectively; the second part has 2 digits, 9 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 40381-91:
(7*4)+(6*0)+(5*3)+(4*8)+(3*1)+(2*9)+(1*1)=97
97 % 10 = 7
So 40381-91-7 is a valid CAS Registry Number.
InChI:InChI=1/C6HCl3N2/c7-4-1-5(8)11-6(9)3(4)2-10/h1H
