40469-87-2 Usage
General Description
3-AMINO-4-METHYLHEXANOIC ACID is a chemical compound with the molecular formula C7H15NO2. It is also known as 4-Methyl-3-aminocaproic acid and is classified as an amino acid derivative. 3-AMINO-4-METHYLHEXANOIC ACID is commonly used as a pharmaceutical intermediate and is known for its ability to inhibit fibrinolysis, making it a potential treatment for excessive bleeding conditions. Additionally, it has been studied for its potential in promoting blood clotting and reducing postoperative blood loss. 3-AMINO-4-METHYLHEXANOIC ACID is also used in the synthesis of various pharmaceuticals and is an important building block in organic chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 40469-87-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,0,4,6 and 9 respectively; the second part has 2 digits, 8 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 40469-87:
(7*4)+(6*0)+(5*4)+(4*6)+(3*9)+(2*8)+(1*7)=122
122 % 10 = 2
So 40469-87-2 is a valid CAS Registry Number.
InChI:InChI=1/C7H15NO2/c1-3-5(2)6(8)4-7(9)10/h5-6H,3-4,8H2,1-2H3,(H,9,10)/t5-,6-/m1/s1
