40484-49-9 Usage
Description
2-Methylbenz[c,d]indole is a chemical compound that is derived from 1-Acetamidonaphthalene (A158455). It is characterized by the presence of a methyl group attached to the benzene ring and a fused indole ring. 2-Methylbenz[c,d]indole plays a significant role in the synthesis of various dyes and fluorescent sensors.
Uses
Used in Fluorescent Sensor Applications:
2-Methylbenz[c,d]indole is used as a key intermediate in the synthesis of benzo[c,d]indole-based dimethine cyanine dyes. These dyes are particularly useful as an OFF-ON-OFF type of pH fluorescent sensor. They exhibit a unique fluorescence response to changes in pH levels, making them valuable tools in various analytical and diagnostic applications.
Used in Chemical Synthesis Industry:
In the chemical synthesis industry, 2-Methylbenz[c,d]indole is utilized as a building block for the development of new compounds with potential applications in various fields, such as pharmaceuticals, materials science, and environmental analysis. Its unique structure and reactivity make it a versatile component in the synthesis of complex organic molecules.
Used in Research and Development:
2-Methylbenz[c,d]indole is also employed in research and development settings, where it serves as a model compound for studying the properties and behavior of similar indole-containing compounds. This helps scientists gain insights into the structure-activity relationships and potential applications of these compounds in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 40484-49-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,0,4,8 and 4 respectively; the second part has 2 digits, 4 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 40484-49:
(7*4)+(6*0)+(5*4)+(4*8)+(3*4)+(2*4)+(1*9)=109
109 % 10 = 9
So 40484-49-9 is a valid CAS Registry Number.
InChI:InChI=1/C12H9N/c1-8-10-6-2-4-9-5-3-7-11(13-8)12(9)10/h2-7H,1H3