405-30-1 Usage
Description
1-chloro-4-[(4-fluorophenyl)sulfanylmethyl]benzene is an organic compound characterized by its chemical structure that features a benzene ring with a chlorine atom at the 1st position and a 4-fluorophenylsulfanylmethyl group attached to the 4th position. It exists as crystals and is insoluble in water but soluble in acetone and oils.
Uses
Used in Pesticide Industry:
1-chloro-4-[(4-fluorophenyl)sulfanylmethyl]benzene is used as an acaricide for controlling and eliminating acarine pests, such as mites and ticks, in agricultural settings. Its chemical properties make it effective in targeting and eliminating these pests, thus protecting crops and reducing the need for other, potentially more harmful, pest control methods.
The provided materials do not specify any other industries or applications for 1-chloro-4-[(4-fluorophenyl)sulfanylmethyl]benzene. However, given its chemical properties and uses as an acaricide, it is likely that this compound could be further researched and developed for additional applications in various industries, such as pharmaceuticals or materials science, depending on its specific characteristics and potential benefits.
Check Digit Verification of cas no
The CAS Registry Mumber 405-30-1 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 4,0 and 5 respectively; the second part has 2 digits, 3 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 405-30:
(5*4)+(4*0)+(3*5)+(2*3)+(1*0)=41
41 % 10 = 1
So 405-30-1 is a valid CAS Registry Number.
InChI:InChI=1/C13H10ClFS/c14-11-3-1-10(2-4-11)9-16-13-7-5-12(15)6-8-13/h1-8H,9H2
