40755-07-5 Usage
Type of compound
Urea derivative
Functional groups
Allyl group and propylbutyl group attached to the nitrogen atom
Usage
a. Production of industrial products (plastics, resins, and adhesives)
b. Reagent in organic synthesis
c. Catalyst for chemical reactions
Potential applications
a. Pharmaceuticals
b. Agrochemicals
Importance
Versatile and important chemical in various industries due to its unique structure and properties
Check Digit Verification of cas no
The CAS Registry Mumber 40755-07-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,0,7,5 and 5 respectively; the second part has 2 digits, 0 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 40755-07:
(7*4)+(6*0)+(5*7)+(4*5)+(3*5)+(2*0)+(1*7)=105
105 % 10 = 5
So 40755-07-5 is a valid CAS Registry Number.
InChI:InChI=1/C11H22N2O/c1-4-7-10(8-5-2)13-11(14)12-9-6-3/h6,10H,3-5,7-9H2,1-2H3,(H2,12,13,14)