4092-64-2 Usage
Description
Rosinidin chloride is a natural anthocyanin compound that serves as a substituent for hDHFR, a potential cancer drug target. It is derived from various plant sources and exhibits unique chemical properties that make it a promising candidate for pharmaceutical applications.
Uses
Used in Pharmaceutical Industry:
Rosinidin chloride is used as a substituent for hDHFR (human dihydrofolate reductase), a potential target for cancer drug development. Its unique chemical properties and natural origin make it a promising candidate for the development of novel cancer therapeutics.
Used in Cancer Drug Development:
Rosinidin chloride is being studied for its potential as a cancer drug, particularly as a substituent for hDHFR. Its ability to target this enzyme may lead to the development of new and effective cancer treatments.
Check Digit Verification of cas no
The CAS Registry Mumber 4092-64-2 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 4,0,9 and 2 respectively; the second part has 2 digits, 6 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 4092-64:
(6*4)+(5*0)+(4*9)+(3*2)+(2*6)+(1*4)=82
82 % 10 = 2
So 4092-64-2 is a valid CAS Registry Number.
InChI:InChI=1/C17H14O6/c1-21-10-6-13(19)11-8-14(20)17(23-15(11)7-10)9-3-4-12(18)16(5-9)22-2/h3-8H,1-2H3,(H2-,18,19,20)/p+1
