412332-18-4 Usage
General Description
3-Aminomethyl-1,3-dihydro-indol-2-one is a chemical compound that belongs to the class of indole derivatives. It is an intermediate in the synthesis of potential pharmaceutical compounds and has shown potential therapeutic properties in anti-depressive and anti-inflammatory treatments. The compound has a bicyclic structure with an amine group and a carbonyl group, making it a versatile building block for the synthesis of various medicinal compounds. Its unique structure and potential therapeutic properties make it a valuable compound in the field of medicinal chemistry and drug development.
Check Digit Verification of cas no
The CAS Registry Mumber 412332-18-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,1,2,3,3 and 2 respectively; the second part has 2 digits, 1 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 412332-18:
(8*4)+(7*1)+(6*2)+(5*3)+(4*3)+(3*2)+(2*1)+(1*8)=94
94 % 10 = 4
So 412332-18-4 is a valid CAS Registry Number.
InChI:InChI=1/C9H10N2O/c10-5-7-6-3-1-2-4-8(6)11-9(7)12/h1-4,7H,5,10H2,(H,11,12)