41421-27-6 Usage
Description
5-(3,4-Dichlorophenyl)-1H-tetrazole is a chemical compound with the molecular formula C8H5Cl2N3. It is classified as a tetrazole derivative and is commonly used in organic synthesis and pharmaceutical research. 5-(3,4-DICHLOROPHENYL)-1H-TETRAZOLE is known for its unique structural properties and potential biological activities, making it an important molecule for further research and development in various scientific disciplines.
Uses
Used in Pharmaceutical Research:
5-(3,4-Dichlorophenyl)-1H-tetrazole is used as a key intermediate in the synthesis of various pharmaceutical compounds. Its antimicrobial and fungicidal properties make it a potential candidate for the development of new drugs and treatment options.
Used in Organic Synthesis:
In the field of organic synthesis, 5-(3,4-Dichlorophenyl)-1H-tetrazole is used as a building block for the creation of complex organic molecules. Its unique structural properties allow for versatile chemical reactions and the formation of diverse molecular structures.
Used in Material Science:
5-(3,4-Dichlorophenyl)-1H-tetrazole is used in material science for its coordination properties with transition metals. This allows for the development of new materials with unique properties and potential applications in various industries.
Overall, 5-(3,4-Dichlorophenyl)-1H-tetrazole is a versatile chemical compound with a wide range of applications in pharmaceutical research, organic synthesis, and material science. Its unique properties and potential for further research make it an important molecule for the advancement of scientific knowledge and the development of innovative products.
Check Digit Verification of cas no
The CAS Registry Mumber 41421-27-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,1,4,2 and 1 respectively; the second part has 2 digits, 2 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 41421-27:
(7*4)+(6*1)+(5*4)+(4*2)+(3*1)+(2*2)+(1*7)=76
76 % 10 = 6
So 41421-27-6 is a valid CAS Registry Number.
InChI:InChI=1/C7H4Cl2N4/c8-5-2-1-4(3-6(5)9)7-10-12-13-11-7/h1-3H,(H,10,11,12,13)
41421-27-6Relevant articles and documents
Design and synthesis of low molecular weight compounds with complement inhibition activity
Master, Hoshang E.,Khan, Shabana I.,Poojari, Krishna A.
, p. 4891 - 4899 (2007/10/03)
An attempt was made to synthesize a series of non-cytotoxic low molecular weight compounds of varying substitutions and functionalities having pharmacophore activity like carbonyl compounds, carboxylic acid and bioisosteres like tetrazole and phenyl acrylic acid. The in vitro assay of these analogues for the inhibition of complement activity revealed significant inhibitory activity for varying substituents and, particularly, for bioisosteres, that is, tetrazole and phenyl acrylic acid derivatives.
