414885-80-6 Usage
General Description
1-(3-bromobenzyl)-4-methylperhydro-1,4-diazepine is a chemical compound that is comprised of a perhydro-1,4-diazepine ring system with a methyl group and a 3-bromobenzyl substitution. 1-(3-bromobenzyl)-4-methylperhydro-1,4-diazepine has potential applications in medicinal chemistry, as it can act as a scaffold for drug discovery and development. The presence of the bromine atom and the benzyl group make it a useful starting material for the synthesis of various pharmacologically active compounds. Additionally, the inclusion of the methyl group could influence the compound's biological activity and pharmacokinetic properties. The synthesis and study of 1-(3-bromobenzyl)-4-methylperhydro-1,4-diazepine could provide valuable insights for the development of new therapeutic agents with improved efficacy and safety profiles.
Check Digit Verification of cas no
The CAS Registry Mumber 414885-80-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,1,4,8,8 and 5 respectively; the second part has 2 digits, 8 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 414885-80:
(8*4)+(7*1)+(6*4)+(5*8)+(4*8)+(3*5)+(2*8)+(1*0)=166
166 % 10 = 6
So 414885-80-6 is a valid CAS Registry Number.
InChI:InChI=1/C13H19BrN2/c1-15-6-3-7-16(9-8-15)11-12-4-2-5-13(14)10-12/h2,4-5,10H,3,6-9,11H2,1H3
