41727-45-1 Usage
Description
4-(Allyloxy)-3,5-dichlorobenzoic acid is a chemical compound with the molecular formula C11H9Cl2O3. It is a derivative of benzoic acid and contains two chlorine atoms and an allyloxy group. This versatile compound possesses unique chemical properties that make it suitable for a range of applications in various industries.
Uses
Used in Chemical Industry:
4-(Allyloxy)-3,5-dichlorobenzoic acid is used as an intermediate in the production of other organic compounds. Its chemical properties allow it to be a key component in the synthesis of various chemical products.
Used in Pharmaceutical Industry:
4-(Allyloxy)-3,5-dichlorobenzoic acid is used as a building block in the synthesis of new materials and pharmaceuticals. Its unique structure contributes to the development of innovative drugs and therapeutic agents.
Used in Material Science:
4-(Allyloxy)-3,5-dichlorobenzoic acid is utilized in the development of new materials due to its chemical properties. It can be incorporated into the design and synthesis of advanced materials for various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 41727-45-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,1,7,2 and 7 respectively; the second part has 2 digits, 4 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 41727-45:
(7*4)+(6*1)+(5*7)+(4*2)+(3*7)+(2*4)+(1*5)=111
111 % 10 = 1
So 41727-45-1 is a valid CAS Registry Number.
InChI:InChI=1/C10H8Cl2O3/c1-2-3-15-9-7(11)4-6(10(13)14)5-8(9)12/h2,4-5H,1,3H2,(H,13,14)
41727-45-1Relevant articles and documents
Enantioselective cation-exchange materials
-
Page/Page column 22, (2010/11/08)
The present invention relates to an enantioselective cation-exchange material, comprising a chiral selector (1), composed of a chiral component (2) and at least one cation-exchange group (X), a spacer (3) and a carrier (4). The cation-exchange material is characterized in that the chiral component (2) has a molecular weight of less than 1,000 and the at least one cation-exchange group (X) is an acid group having a pKa4.0.