42278-67-1 Usage
Description
Potassium triisopropoxyborohydride is a chemical compound that serves as a reducing agent in various chemical reactions. It is a colorless to light yellow solution and is known for its ability to facilitate the synthesis of different compounds.
Uses
Used in Pharmaceutical Industry:
Potassium triisopropoxyborohydride is used as a reducing agent for the synthesis of Halostachine (M227375), which is a key intermediate in the development of novel hydrazine inhibitors. These inhibitors have potential applications in the treatment of various diseases and conditions, making the compound an essential tool in the pharmaceutical industry.
Used in Chemical Synthesis:
In the field of chemical synthesis, Potassium triisopropoxyborohydride is utilized as a reducing agent to facilitate the production of various compounds. Its ability to reduce specific functional groups makes it a valuable asset in the synthesis of complex molecules and contributes to the advancement of chemical research and development.
Check Digit Verification of cas no
The CAS Registry Mumber 42278-67-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,2,2,7 and 8 respectively; the second part has 2 digits, 6 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 42278-67:
(7*4)+(6*2)+(5*2)+(4*7)+(3*8)+(2*6)+(1*7)=121
121 % 10 = 1
So 42278-67-1 is a valid CAS Registry Number.
InChI:InChI=1/C9H21BO3.K/c1-7(2)11-10(12-8(3)4)13-9(5)6;/h7-9H,1-6H3;/q-1;+1
