42471-42-1 Usage
General Description
N-(2-chloroethyl)-N'-[2-(2-pyridinyl)ethyl]urea is a chemical compound that is a member of the urea family and contains a chloroethyl group and a pyridinyl group in its structure. It is used in the synthesis of pharmaceuticals and can act as a building block for creating other organic compounds. This chemical is typically handled and stored in a controlled environment due to its potential hazards and toxic properties. It may also have applications in the field of medicinal chemistry and drug development due to its unique structure and potential biological activity. Overall, N-(2-chloroethyl)-N'-[2-(2-pyridinyl)ethyl]urea is a versatile compound that has potential uses in various chemical and pharmaceutical applications.
Check Digit Verification of cas no
The CAS Registry Mumber 42471-42-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,2,4,7 and 1 respectively; the second part has 2 digits, 4 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 42471-42:
(7*4)+(6*2)+(5*4)+(4*7)+(3*1)+(2*4)+(1*2)=101
101 % 10 = 1
So 42471-42-1 is a valid CAS Registry Number.
InChI:InChI=1/C10H14ClN3O/c11-5-8-14-10(15)13-7-4-9-3-1-2-6-12-9/h1-3,6H,4-5,7-8H2,(H2,13,14,15)
