424823-07-4 Usage
Description
2-Methyl-cyclopentane-1,3-dione, also known as 2-Methyl-1,3-cyclopentanedione, is a cyclic diketone with the molecular formula C6H8O2. It features a five-membered ring structure with two ketone groups attached to adjacent carbon atoms and a methyl group on the second carbon. 2-Methyl-cyclopentane-1,3-dione has a faint, sweet odor and is known for its stability and combustibility, requiring careful handling and storage.
Uses
Used in Pharmaceutical Production:
2-Methyl-cyclopentane-1,3-dione serves as an essential intermediate in the synthesis of various pharmaceuticals. Its unique chemical structure allows it to be a key component in the development of new drugs, contributing to the advancement of medicinal chemistry.
Used in Organic Synthesis:
In the field of organic synthesis, 2-Methyl-cyclopentane-1,3-dione is utilized as a versatile building block for the creation of a wide range of organic compounds. Its reactivity and structural features make it suitable for various chemical reactions, enabling the synthesis of complex organic molecules for different applications.
Used in Chemical Research:
2-Methyl-cyclopentane-1,3-dione is also employed in chemical research to study the properties and reactions of cyclic diketones. Its unique structure provides insights into the behavior of similar compounds, aiding in the understanding of their chemical properties and potential applications.
Check Digit Verification of cas no
The CAS Registry Mumber 424823-07-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,2,4,8,2 and 3 respectively; the second part has 2 digits, 0 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 424823-07:
(8*4)+(7*2)+(6*4)+(5*8)+(4*2)+(3*3)+(2*0)+(1*7)=134
134 % 10 = 4
So 424823-07-4 is a valid CAS Registry Number.
InChI:InChI=1/C6H8O2/c1-4-5(7)2-3-6(4)8/h7H,2-3H2,1H3
