4274-06-0 Usage
Chemical class
Azo dyes
A class of organic compounds that contain the azo group (-N=N-) in their molecular structure.
Usage
Colorants in various industries
Commonly used in industries such as textiles, printing, and food to provide color to products.
Molecular structure
Complex
The compound has a complex molecular structure, which contributes to its properties and potential hazards.
Functional groups
Chloro-nitrophenylazo, methoxy, and p-toluidine groups
The presence of these groups gives the compound its characteristic properties, such as color and insolubility in water.
Color
Yellow to orange
The compound exhibits a yellow to orange color due to the presence of its functional groups.
Solubility
Insoluble in water
The compound is insoluble in water, which may affect its application and handling.
Potential hazards
Toxic and harmful
The compound may be toxic and harmful if ingested, inhaled, or exposed to the skin, posing potential health and environmental risks.
Safety measures
Proper handling and usage
It is essential to take proper safety measures when handling and using this compound to minimize exposure and potential hazards.
Check Digit Verification of cas no
The CAS Registry Mumber 4274-06-0 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 4,2,7 and 4 respectively; the second part has 2 digits, 0 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 4274-06:
(6*4)+(5*2)+(4*7)+(3*4)+(2*0)+(1*6)=80
80 % 10 = 0
So 4274-06-0 is a valid CAS Registry Number.
InChI:InChI=1/C14H13ClN4O3/c1-8-5-13(11(16)7-14(8)22-2)18-17-12-4-3-9(19(20)21)6-10(12)15/h3-7H,16H2,1-2H3/b18-17+
