42780-48-3 Usage
Chemical structure
A nitrile derivative with a 4-chlorophenyl group, a 2,5-dimethyl-1H-pyrrol-3-yl group, and an acetonitrile group.
Pharmaceutical industry use
Commonly used as a building block for the synthesis of various drugs and bioactive compounds.
Anticonvulsant properties
Exhibits potential anticonvulsant properties, making it a promising candidate for the development of new medications for neurological disorders.
Sedative properties
Has been found to exhibit potential sedative properties.
Precursor for functionalized pyrrole derivatives
Studied for its potential use as a precursor for other functionalized pyrrole derivatives with various biological activities.
Versatility
A versatile chemical with potential applications in drug development and medicinal chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 42780-48-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,2,7,8 and 0 respectively; the second part has 2 digits, 4 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 42780-48:
(7*4)+(6*2)+(5*7)+(4*8)+(3*0)+(2*4)+(1*8)=123
123 % 10 = 3
So 42780-48-3 is a valid CAS Registry Number.
InChI:InChI=1/C14H13ClN2/c1-10-9-12(7-8-16)11(2)17(10)14-5-3-13(15)4-6-14/h3-6,9H,7H2,1-2H3
