42901-97-3 Usage
General Description
3-Cyano-2-ethylbenzofuran is a chemical compound with the molecular formula C13H11NO. It is a benzofuran derivative with a cyano group and an ethyl substituent at the 3 and 2 positions, respectively. 3-Cyano-2-ethylbenzofuran is commonly used in organic synthesis and pharmaceutical research. It possesses interesting pharmacological properties, such as anti-inflammatory and antioxidant activities, which make it a potential candidate for the development of new drugs. Additionally, 3-Cyano-2-ethylbenzofuran has been reported to exhibit cytotoxic effects against certain cancer cell lines, further highlighting its potential in medicinal chemistry. Overall, this chemical compound has garnered attention for its diverse applications in various scientific fields.
Check Digit Verification of cas no
The CAS Registry Mumber 42901-97-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,2,9,0 and 1 respectively; the second part has 2 digits, 9 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 42901-97:
(7*4)+(6*2)+(5*9)+(4*0)+(3*1)+(2*9)+(1*7)=113
113 % 10 = 3
So 42901-97-3 is a valid CAS Registry Number.
InChI:InChI=1/C11H9NO/c1-2-10-9(7-12)8-5-3-4-6-11(8)13-10/h3-6H,2H2,1H3