43027-41-4 Usage
Description
2-Chloromethyl-1,4-naphthoquinone is an organic compound with the molecular formula C11H5ClO3. It is characterized by the presence of a chloromethyl group (-CH2Cl) attached to the second carbon atom and a 1,4-naphthoquinone moiety, which is a naphthalene ring with a quinone functional group at the 1 and 4 positions. 2-Chloromethyl-1,4-naphthoquinone is known for its potential applications in various fields due to its unique chemical properties.
Uses
Used in Pharmaceutical Industry:
2-Chloromethyl-1,4-naphthoquinone is used as an inhibitor for NADH-oxidase and succinoxidase enzymes. Its application in this field is due to its ability to interfere with the electron transport chain in cells, which can be useful in the development of drugs targeting specific metabolic pathways or cellular processes.
Used in Chemical Research:
In the field of chemical research, 2-Chloromethyl-1,4-naphthoquinone serves as a valuable intermediate compound for the synthesis of various other organic compounds. Its unique structure allows for further functionalization and modification, making it a versatile building block for the development of new molecules with potential applications in various industries.
Used in Environmental Applications:
2-Chloromethyl-1,4-naphthoquinone can be utilized in environmental applications, such as the development of new materials for water treatment or air purification. Its chemical properties may allow it to interact with pollutants or contaminants, enabling its use in the removal or degradation of harmful substances in the environment.
Check Digit Verification of cas no
The CAS Registry Mumber 43027-41-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,3,0,2 and 7 respectively; the second part has 2 digits, 4 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 43027-41:
(7*4)+(6*3)+(5*0)+(4*2)+(3*7)+(2*4)+(1*1)=84
84 % 10 = 4
So 43027-41-4 is a valid CAS Registry Number.
InChI:InChI=1/C11H7ClO2/c12-6-7-5-10(13)8-3-1-2-4-9(8)11(7)14/h1-5H,6H2
43027-41-4Relevant articles and documents
Lin et al.
, p. 1268,1271 (1973)
2-and 6-methyl-1,4-naphthoquinone derivatives as potential bioreductive alkylating agents
Antonini,Lin,Cosby,Dai,Sartorelli
, p. 730 - 735 (2007/10/02)
A number of antineoplastic agents possess both the quinone nucleus and an appropriate substituent that permits them to function as bioreductive alkylating agents. To develop new compounds of this type with unique properties, the authors have synthesized a
