43168-73-6 Usage
Description
(2-methoxy-3,6-dioxabicyclo[3.1.0]hex-4-yl)methanol is a chemical compound with a bicyclic structure and a methoxy group attached to it. It is a derivative of bicyclo[3.1.0]hexane, a class of compounds known for their rigid and stable structure.
Uses
Used in Pharmaceutical Industry:
(2-methoxy-3,6-dioxabicyclo[3.1.0]hex-4-yl)methanol is used as a building block in organic synthesis for the production of pharmaceuticals. Its unique structure and functional groups make it a valuable intermediate in the synthesis of various complex organic molecules.
Used in Agrochemical Industry:
(2-methoxy-3,6-dioxabicyclo[3.1.0]hex-4-yl)methanol is used as a building block in organic synthesis for the production of agrochemicals. Its methoxy group can provide certain biological activities or improve the solubility of the resulting compounds, making it a useful moiety in agrochemical development.
Check Digit Verification of cas no
The CAS Registry Mumber 43168-73-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,3,1,6 and 8 respectively; the second part has 2 digits, 7 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 43168-73:
(7*4)+(6*3)+(5*1)+(4*6)+(3*8)+(2*7)+(1*3)=116
116 % 10 = 6
So 43168-73-6 is a valid CAS Registry Number.
InChI:InChI=1/C6H10O4/c1-8-6-5-4(10-5)3(2-7)9-6/h3-7H,2H2,1H3