433242-64-9 Usage
General Description
The chemical 2-(4,6-dimethyl-pyrimidin-2-ylsulfanyl)-butyric acid is a compound with the molecular formula C11H16N2O2S. It is a derivative of butyric acid with a pyrimidine ring attached to the butyric acid backbone. 2-(4,6-DIMETHYL-PYRIMIDIN-2-YLSULFANYL)-BUTYRIC ACID is often used in pharmaceutical research as a potential drug candidate due to its potential biological activities. Its precise uses and properties may vary depending on the specific research or application, but it is known to have potential therapeutic properties and is being studied for its potential anti-inflammatory and immunomodulatory effects.
Check Digit Verification of cas no
The CAS Registry Mumber 433242-64-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,3,3,2,4 and 2 respectively; the second part has 2 digits, 6 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 433242-64:
(8*4)+(7*3)+(6*3)+(5*2)+(4*4)+(3*2)+(2*6)+(1*4)=119
119 % 10 = 9
So 433242-64-9 is a valid CAS Registry Number.
InChI:InChI=1/C10H14N2O2S/c1-4-8(9(13)14)15-10-11-6(2)5-7(3)12-10/h5,8H,4H2,1-3H3,(H,13,14)/p-1/t8-/m1/s1
