436093-32-2 Usage
Description
2-AMINO-3-CHLOROBENZOYL-5-METHYLTHIOPHENE is an organic compound characterized by its white to off-white solid appearance. It is a chemical intermediate that plays a significant role in the synthesis of various psychotropic drugs, which are medications that affect the mind, emotions, and behavior.
Uses
Used in Pharmaceutical Industry:
2-AMINO-3-CHLOROBENZOYL-5-METHYLTHIOPHENE is used as a chemical intermediate for the preparation of psychotropic drugs. Its unique chemical structure allows it to be a crucial component in the development of medications that target mental health disorders and conditions.
As a chemical intermediate, 2-AMINO-3-CHLOROBENZOYL-5-METHYLTHIOPHENE contributes to the synthesis of psychotropic drugs by providing a foundation for further chemical reactions and modifications. This enables the creation of a wide range of medications that can be used to treat various mental health issues, such as anxiety, depression, and schizophrenia.
Check Digit Verification of cas no
The CAS Registry Mumber 436093-32-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,3,6,0,9 and 3 respectively; the second part has 2 digits, 3 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 436093-32:
(8*4)+(7*3)+(6*6)+(5*0)+(4*9)+(3*3)+(2*3)+(1*2)=142
142 % 10 = 2
So 436093-32-2 is a valid CAS Registry Number.
InChI:InChI=1/C12H10ClNOS/c1-7-5-6-10(16-7)12(15)8-3-2-4-9(13)11(8)14/h2-6H,14H2,1H3
436093-32-2Relevant articles and documents
6H-THIENO[2,3-E][1,2,4]TRIAZOLO[3,4-C][1,2,4]TRIAZEPINE DERIVATIVE
-
, (2020/05/07)
The 6H-thieno[2,3-e][1,2,4]triazolo[3,4-c][1,2,4]triazepine derivatives or salts thereof of the present invention have BRD4 inhibitory activity, and thus, they are useful as medicaments, in particular, as prophylaxis and/or therapeutic agents for diseases associated with BRD4.
