436096-79-6 Usage
General Description
(4-ethyl-benzyl)-pyridin-3-ylmethyl-amine is a chemical compound with a complex molecular structure. The compound contains an ethyl group, a benzyl group, and a pyridine group, as well as an amine functional group. This chemical is commonly used in pharmaceutical and therapeutic applications due to its potential biological activity. The presence of the amine group suggests that it may be a basic compound, and the presence of the aromatic ring indicates potential for interactions with biological receptors. Overall, (4-ethyl-benzyl)-pyridin-3-ylmethyl-amine is a complex compound with potential for various applications in the pharmaceutical and chemical industries.
Check Digit Verification of cas no
The CAS Registry Mumber 436096-79-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,3,6,0,9 and 6 respectively; the second part has 2 digits, 7 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 436096-79:
(8*4)+(7*3)+(6*6)+(5*0)+(4*9)+(3*6)+(2*7)+(1*9)=166
166 % 10 = 6
So 436096-79-6 is a valid CAS Registry Number.
InChI:InChI=1/C15H18N2/c1-2-13-5-7-14(8-6-13)10-17-12-15-4-3-9-16-11-15/h3-9,11,17H,2,10,12H2,1H3/p+1
