438-59-5 Usage
Description
3-(5H-dibenzo[a,d]cyclohepten-5-ylidene)propyl(methyl)ammonium chloride is a complex organic compound with a unique chemical structure. It is characterized by its dibenzo[a,d]cyclohepten-5-ylidene moiety and a quaternary ammonium group, which may contribute to its potential applications in various fields.
Uses
Used in Pharmaceutical Applications:
3-(5H-dibenzo[a,d]cyclohepten-5-ylidene)propyl(methyl)ammonium chloride is used as an active pharmaceutical ingredient for the treatment of various medical conditions. Its specific application reason is not provided in the materials, but its unique chemical structure suggests that it may have potential therapeutic properties.
Used in Chemical Research:
3-(5H-dibenzo[a,d]cyclohepten-5-ylidene)propyl(methyl)ammonium chloride is used as a research compound for studying its chemical properties and potential applications in various industries. Its complex structure and unique features make it an interesting subject for further investigation and development.
Used in Analytical Chemistry:
3-(5H-dibenzo[a,d]cyclohepten-5-ylidene)propyl(methyl)ammonium chloride is used as a reference material or standard for analytical methods such as gas chromatography/mass spectrometry (GC/MS) or liquid chromatography/mass spectrometry (LC/MS). Its role in these applications is to help ensure the accuracy and reliability of test results in various fields, including pharmaceutical analysis, forensic analysis, and clinical toxicology.
Please note that the specific applications and reasons for using 3-(5H-dibenzo[a,d]cyclohepten-5-ylidene)propyl(methyl)ammonium chloride are not provided in the materials. The uses listed above are inferred based on the general context of similar compounds and their typical applications.
Check Digit Verification of cas no
The CAS Registry Mumber 438-59-5 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 4,3 and 8 respectively; the second part has 2 digits, 5 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 438-59:
(5*4)+(4*3)+(3*8)+(2*5)+(1*9)=75
75 % 10 = 5
So 438-59-5 is a valid CAS Registry Number.
InChI:InChI=1/C19H19N.ClH/c1-20-14-6-11-19-17-9-4-2-7-15(17)12-13-16-8-3-5-10-18(16)19;/h2-5,7-13,20H,6,14H2,1H3;1H