4429-04-3 Usage
General Description
The chemical compound (2R,3S,4R,5R)-2-(aminomethyl)oxane-2,3,4,5-tetrol, also known as L-glucoseamine, is a rare and unique sugar derivative that contains four carbon atoms and four hydroxyl groups. It is a natural compound that can be found in certain marine organisms and bacterial species, and it possesses potential medicinal and therapeutic properties. L-glucoseamine has been studied for its potential role in treating neurodegenerative diseases, such as Alzheimer's and Parkinson's, as well as for its potential anti-inflammatory and antioxidant effects. Its complex structure and unique properties make it an intriguing molecule for further research and potential drug development.
Check Digit Verification of cas no
The CAS Registry Mumber 4429-04-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 4,4,2 and 9 respectively; the second part has 2 digits, 0 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 4429-04:
(6*4)+(5*4)+(4*2)+(3*9)+(2*0)+(1*4)=83
83 % 10 = 3
So 4429-04-3 is a valid CAS Registry Number.
InChI:InChI=1/C6H13NO5/c7-2-6(11)5(10)4(9)3(8)1-12-6/h3-5,8-11H,1-2,7H2/t3-,4-,5+,6?/m1/s1
