443799-45-9 Usage
General Description
N3-(4-(1H-imidazol-1-yl)phenyl)-1H-1,2,4-triazole-3,5-diamine is a chemical compound with the molecular formula C11H10N6. It is a triazole derivative that contains both an imidazole and a phenyl group. N3-(4-(1H-IMIDAZOL-1-YL)PHENYL)-1H-1,2,4-TRIAZOLE-3,5-DIAMINE is used in scientific research as a potential drug target and inhibitor for various biological pathways. Its structure suggests that it may have potential as an anti-cancer or anti-inflammatory drug, although more research is needed to fully understand its properties and potential applications.
Check Digit Verification of cas no
The CAS Registry Mumber 443799-45-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,4,3,7,9 and 9 respectively; the second part has 2 digits, 4 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 443799-45:
(8*4)+(7*4)+(6*3)+(5*7)+(4*9)+(3*9)+(2*4)+(1*5)=189
189 % 10 = 9
So 443799-45-9 is a valid CAS Registry Number.
InChI:InChI=1/C11H11N7/c12-10-15-11(17-16-10)14-8-1-3-9(4-2-8)18-6-5-13-7-18/h1-7H,(H4,12,14,15,16,17)