445390-53-4 Usage
General Description
N-(carboxymethyl)-N-[6-(2,5-dihydro-2,5-dioxo-1H-pyrrol-1-yl)hexyl]- Glycine is a chemical compound that is derived from glycine, an essential amino acid. N-(carboxymethyl)-N-[6-(2,5-dihydro-2,5-dioxo-1H-pyrrol-1-yl)hexyl]- Glycine contains a carboxymethyl group and a pyrrol-1-ylhexyl group, which are both important functional groups in organic chemistry. The presence of these groups makes N-(carboxymethyl)-N-[6-(2,5-dihydro-2,5-dioxo-1H-pyrrol-1-yl)hexyl]- Glycine potentially useful in pharmaceutical and biotechnological applications, particularly as a building block for the synthesis of complex molecules. Additionally, the chemical structure of N-(carboxymethyl)-N-[6-(2,5-dihydro-2,5-dioxo-1H-pyrrol-1-yl)hexyl]- Glycine makes it a potential candidate for drug design and development due to its unique properties and potential biological activities. Further research into the compound's properties and potential uses is warranted.
Check Digit Verification of cas no
The CAS Registry Mumber 445390-53-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,4,5,3,9 and 0 respectively; the second part has 2 digits, 5 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 445390-53:
(8*4)+(7*4)+(6*5)+(5*3)+(4*9)+(3*0)+(2*5)+(1*3)=154
154 % 10 = 4
So 445390-53-4 is a valid CAS Registry Number.
InChI:InChI=1/C14H20N2O6/c17-11-5-6-12(18)16(11)8-4-2-1-3-7-15(9-13(19)20)10-14(21)22/h5-6H,1-4,7-10H2,(H,19,20)(H,21,22)
