4514-54-9 Usage
General Description
6-(3-Chlorophenyl)-1,3,5-triazine-2,4-diamine is a chemical compound with the molecular formula C9H7ClN6. It is a member of the triazine class of compounds and is characterized by the presence of a 1,3,5-triazine ring with two amino groups and a 3-chlorophenyl substituent. This chemical has been studied for its potential applications in organic synthesis and medicinal chemistry. It is also used as a building block for the preparation of various derivatives with potentially useful biological and pharmacological properties. Additionally, it is being investigated for its potential as an anti-cancer agent due to its ability to inhibit certain cellular processes. Overall, 6-(3-chlorophenyl)-1,3,5-triazine-2,4-diamine is a versatile compound with diverse potential applications in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 4514-54-9 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 4,5,1 and 4 respectively; the second part has 2 digits, 5 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 4514-54:
(6*4)+(5*5)+(4*1)+(3*4)+(2*5)+(1*4)=79
79 % 10 = 9
So 4514-54-9 is a valid CAS Registry Number.
InChI:InChI=1/C9H8ClN5/c10-6-3-1-2-5(4-6)7-13-8(11)15-9(12)14-7/h1-4H,(H4,11,12,13,14,15)
