452972-09-7 Usage
Description
5-Bromopyridine-3-boronic acid is a white to light yellow crystalline powder, which is a boronic acid derivative of pyridine with a bromine atom at the 5th position. It is a versatile chemical intermediate used in various organic synthesis processes.
Uses
1. Used in Pharmaceutical Industry:
5-Bromopyridine-3-boronic acid is used as a key intermediate for the synthesis of various pharmaceutical compounds, including A2A adenosine receptor antagonists for the treatment of Parkinson's disease. Its unique structure allows for the development of novel therapeutic agents with potential applications in treating neurological disorders.
2. Used in Chemical Synthesis:
5-Bromopyridine-3-boronic acid is used as a reactant for the preparation of various complex organic molecules, such as thienylpyridyl garlands, arenes, and meso-substituted ABCD-type porphyrins. Its reactivity in cross-coupling and functionalization reactions makes it a valuable building block in the synthesis of diverse chemical structures.
3. Used in Material Science:
In the field of material science, 5-Bromopyridine-3-boronic acid is used as a precursor for the development of novel materials with specific properties. Its ability to form complexes and participate in cross-coupling reactions allows for the creation of new materials with potential applications in various industries.
4. Used in Research and Development:
5-Bromopyridine-3-boronic acid is utilized in research and development for the exploration of new chemical reactions and the synthesis of innovative compounds. Its unique properties make it an attractive candidate for studying new reaction mechanisms and developing new synthetic routes.
5. Used in the Synthesis of Boronate-Amine Complexes:
5-Bromopyridine-3-boronic acid is used in the preparation of 5-hydroxy-1,3,2-dioxaborolan-4-ones boronate-amine complexes through heterocyclization with α-oxocarboxylic acids, followed by subsequent complexation. These complexes have potential applications in various fields, including pharmaceuticals and material science.
Check Digit Verification of cas no
The CAS Registry Mumber 452972-09-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,5,2,9,7 and 2 respectively; the second part has 2 digits, 0 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 452972-09:
(8*4)+(7*5)+(6*2)+(5*9)+(4*7)+(3*2)+(2*0)+(1*9)=167
167 % 10 = 7
So 452972-09-7 is a valid CAS Registry Number.
InChI:InChI=1/C5H5BBrNO2/c7-5-1-4(6(9)10)2-8-3-5/h1-3,9-10H
452972-09-7Relevant articles and documents
Pyrrolopyrimidines and Pyrrolopyridines
-
Page/Page column 50, (2009/07/25)
Compounds of formula I in free or salt or solvate form, wherein X, T1, T3 and T4 have the meanings as indicated in the specification, are useful for treating diseases mediated by the ALK-5 and/or ALK-4 receptor. Pharmaceutical compositions that contain the compounds and processes for preparing the compounds are also described.
New shelf-stable halo- and alkoxy-substituted pyridylboronic acids and their suzuki cross-coupling reactions to yield heteroarylpyridines
Parry, Paul R.,Bryce, Martin R.,Tarbit, Brian
, p. 1035 - 1038 (2007/10/03)
New shelf-stable pyridylboronic acids have been synthesized: bromine-lithium exchange followed by reaction with triisopropylborate (TIPB) yielded 2-fluoro-5-pyridylboronic acid (4), 3-bromo-5-pyridylboronic acid (5) and 2-ethoxy-5-pyridylboronic acid (6);
