4553-30-4 Usage
General Description
Piperazine, 1-(3-amino-1-methylpropyl)-4-methyl- (7CI,8CI) is a chemical compound with the molecular formula C10H22N2. It is a derivative of piperazine, which is commonly used as an anthelmintic agent to treat parasitic worm infections in humans and animals. The specific chemical structure of piperazine, 1-(3-amino-1-methylpropyl)-4-methyl- (7CI,8CI) suggests that it may have potential applications in the pharmaceutical industry, particularly for the development of new antiparasitic drugs. Further research and testing are needed to fully understand the pharmacological properties and potential uses of this chemical compound.
Check Digit Verification of cas no
The CAS Registry Mumber 4553-30-4 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 4,5,5 and 3 respectively; the second part has 2 digits, 3 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 4553-30:
(6*4)+(5*5)+(4*5)+(3*3)+(2*3)+(1*0)=84
84 % 10 = 4
So 4553-30-4 is a valid CAS Registry Number.
InChI:InChI=1/C9H21N3/c1-9(3-4-10)12-7-5-11(2)6-8-12/h9H,3-8,10H2,1-2H3