4572-79-6 Usage
General Description
3-(3,6-Dioxo-3,6-dihydropyridazin-1(2H)-yl)propanoic acid, also known as DHPA, is a chemical compound that belongs to the class of pyridazines. It is a white solid with a molecular formula C8H8N2O4 and a molecular weight of 192.16 g/mol. DHPA is a versatile compound that has been used in various pharmaceutical applications, including as a building block for the synthesis of a range of bioactive molecules. It is known for its potential activity as an antimicrobial, anti-inflammatory, and analgesic agent. Studies have also shown its potential to act as a modulator of the immune system and as an inhibitor of enzymes such as dipeptidyl peptidase-4 (DPP-4). Additionally, DHPA has been investigated for its potential use as a corrosion inhibitor in metal surfaces. Overall, 3-(3,6-Dioxo-3,6-dihydropyridazin-1(2H)-yl)propanoic acid is a valuable and versatile compound with potential applications in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 4572-79-6 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 4,5,7 and 2 respectively; the second part has 2 digits, 7 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 4572-79:
(6*4)+(5*5)+(4*7)+(3*2)+(2*7)+(1*9)=106
106 % 10 = 6
So 4572-79-6 is a valid CAS Registry Number.
InChI:InChI=1/C7H8N2O4/c10-5-1-2-6(11)9(8-5)4-3-7(12)13/h1-2H,3-4H2,(H,8,10)(H,12,13)
