458532-98-4 Usage
Description
3-Chloro-4-pyridineboronic acid hydrate is an organic compound that serves as a crucial building block in the synthesis of various complex molecules. It is characterized by the presence of a chlorine atom at the 3rd position and a boronic acid group at the 4th position of the pyridine ring, with an additional water molecule (hydrate) attached to it. 3-Chloro-4-pyridineboronic acid hydrate is known for its reactivity and versatility in chemical reactions, making it a valuable component in the development of new pharmaceuticals, agrochemicals, and dyes.
Uses
Used in Organic Synthesis:
3-Chloro-4-pyridineboronic acid hydrate is used as a key intermediate for the synthesis of a wide range of organic compounds. Its unique structural features allow it to participate in various chemical reactions, such as Suzuki-Miyaura cross-coupling, which is widely used in the formation of carbon-carbon bonds.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 3-Chloro-4-pyridineboronic acid hydrate is utilized as a starting material for the development of new drugs. Its ability to form diverse chemical structures makes it a valuable asset in the design and synthesis of potential therapeutic agents, particularly those targeting various diseases and medical conditions.
Used in Agrochemicals:
3-Chloro-4-pyridineboronic acid hydrate is also employed in the agrochemical industry as a precursor for the synthesis of pesticides and other crop protection agents. Its incorporation into these compounds can enhance their effectiveness in protecting crops from pests and diseases, ultimately contributing to increased agricultural productivity.
Used in Dye Industry:
In the dye industry, 3-Chloro-4-pyridineboronic acid hydrate is used as a vital component in the production of various types of dyes. Its chemical properties enable the creation of dyes with specific color characteristics and improved performance, making it an essential ingredient in the formulation of dyes for different applications, such as textiles, plastics, and printing inks.
Check Digit Verification of cas no
The CAS Registry Mumber 458532-98-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,5,8,5,3 and 2 respectively; the second part has 2 digits, 9 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 458532-98:
(8*4)+(7*5)+(6*8)+(5*5)+(4*3)+(3*2)+(2*9)+(1*8)=184
184 % 10 = 4
So 458532-98-4 is a valid CAS Registry Number.
InChI:InChI=1/C5H5BClNO2/c7-5-3-8-2-1-4(5)6(9)10/h1-3,9-10H
458532-98-4Relevant articles and documents
Synthesis of novel halopyridinylboronic acids and esters. Part 3: 2, or 3-Halopyridin-4-yl-boronic acids and esters
Bouillon, Alexandre,Lancelot, Jean-Charles,Collot, Valérie,Bovy, Philippe R,Rault, Sylvain
, p. 4369 - 4373 (2007/10/03)
This paper describes a general method for the synthesis and the isolation of novel 2, or 3-halopyridin-4-yl-boronic acids and esters 12-14, 18-20. These compounds are prepared taking in account a regioselective halogen-metal exchange using nBuLi or direct
