4623-25-0 Usage
Description
1,3-DIMETHYL-5-BROMOOROTIC ACID is a chemical compound with the molecular formula C7H7BrNO4. It is a derivative of orotic acid and is commonly used in organic synthesis and pharmaceutical research. 1,3-DIMETHYL-5-BROMOOROTIC ACID contains a 5-bromouracil group and a 1,3-dimethyl group attached to the orotic acid ring, making it a versatile building block in the synthesis of various pharmaceuticals and agrochemicals.
Uses
Used in Pharmaceutical Research:
1,3-DIMETHYL-5-BROMOOROTIC ACID is used as a precursor in the synthesis of pharmaceuticals for its potential biological activities. Its unique structure allows for the development of new drugs with specific therapeutic properties.
Used in Agrochemical Synthesis:
In the agrochemical industry, 1,3-DIMETHYL-5-BROMOOROTIC ACID is used as a building block for the synthesis of various agrochemicals, contributing to the development of effective pest control agents and other agricultural products.
Used in Nucleoside and Nucleotide Analog Synthesis:
1,3-DIMETHYL-5-BROMOOROTIC ACID is utilized as a key component in the synthesis of nucleoside and nucleotide analogs, which have potential applications in antiviral and anticancer drug development. Its incorporation into these analogs can lead to the creation of novel therapeutic agents with improved efficacy and selectivity against viral and cancerous cells.
Check Digit Verification of cas no
The CAS Registry Mumber 4623-25-0 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 4,6,2 and 3 respectively; the second part has 2 digits, 2 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 4623-25:
(6*4)+(5*6)+(4*2)+(3*3)+(2*2)+(1*5)=80
80 % 10 = 0
So 4623-25-0 is a valid CAS Registry Number.
InChI:InChI=1/C7H7BrN2O4/c1-9-4(6(12)13)3(8)5(11)10(2)7(9)14/h1-2H3,(H,12,13)
