4664-16-8 Usage
Description
6-Hydroxy-4-methyl-2-pyridone is an organic compound with the molecular formula C6H7NO2. It is a derivative of pyridone, which is a heterocyclic compound consisting of a six-membered nitrogen-containing ring. This specific compound features a hydroxyl group at the 6th position, a methyl group at the 4th position, and a carbonyl group at the 2nd position. It is known for its potential applications in various fields due to its unique chemical structure and properties.
Uses
Used in Chemical Synthesis:
6-Hydroxy-4-methyl-2-pyridone is used as a synthetic intermediate for the production of various chemical compounds. Its unique structure allows it to be a versatile building block in the synthesis of complex organic molecules, including pharmaceuticals, agrochemicals, and other specialty chemicals.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 6-hydroxy-4-methyl-2-pyridone is used as a key intermediate in the synthesis of macrocycles containing pyridine. These macrocycles have potential applications as therapeutic agents, particularly in the development of new drugs targeting various diseases and conditions.
Used in Agrochemical Industry:
6-Hydroxy-4-methyl-2-pyridone is also utilized in the agrochemical industry for the synthesis of novel compounds with potential pesticidal, herbicidal, or fungicidal properties. Its incorporation into these compounds can enhance their effectiveness and selectivity, leading to improved crop protection and yield.
Used in Material Science:
In the field of material science, 6-hydroxy-4-methyl-2-pyridone can be employed in the development of new materials with specific properties, such as conductivity, magnetism, or optical activity. Its unique chemical structure allows it to be a valuable component in the design and synthesis of advanced materials for various applications, including electronics, sensors, and energy storage devices.
Check Digit Verification of cas no
The CAS Registry Mumber 4664-16-8 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 4,6,6 and 4 respectively; the second part has 2 digits, 1 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 4664-16:
(6*4)+(5*6)+(4*6)+(3*4)+(2*1)+(1*6)=98
98 % 10 = 8
So 4664-16-8 is a valid CAS Registry Number.
InChI:InChI=1/C6H7NO2/c1-4-2-5(8)7-6(9)3-4/h2-3H,1H3,(H2,7,8,9)
4664-16-8Relevant articles and documents
Azo pyridone dyestuffs containing at least one reactive phosphoric or phosphonic acid group
-
, (2008/06/13)
Azo pyridone dyestuffs containing at least one reactive phosphoric or phosphonic acid group. The dyestuffs are characterized by the formula: wherein A is an aromatic radical containing at least one phosphoric or phosphonic acid group and R is a monovalent radical derived from a pyridone coupling component by removing a hydrogen atom attached to a ring carbon atom of the pyridone ring. The aromatic radical A is preferably a phenyl or naphthyl group. In addition to its phosphonic or phosphoric acid group or groups, radical A may be substituted with one or more halogen, alkyl, alkoxy, nitro, sulfonic acid or carboxylic acid groups. Cellulosic textiles, e.g., cotton or cotton/polyester blends, may be reactively dyed with these dyestuffs in an acid, neutral or alkaline bath using dicyandiamide or the equivalent. The phosphoric or phosphonic acid groups and the cellulosic material react to fix the dye through an ester linkage. Examples of suitable dyestuffs include those having the formula: STR1 and STR2
