4733-65-7 Usage
General Description
3-Carbamoylpicolinic Acid, also known as NSC-101511, is a chemical compound that primarily functions as an active pharmaceutical ingredient. Its molecular formula is C7H7NO4, and its IUPAC name is 4-carbamoyl-3-hydroxy-2-pyridinecarboxylic acid. It has a molecular weight of 183.14 g/mol. This chemical is expected to be soluble in water, given its polar characteristics due to the presence of hydroxyl and carbonyl functional groups. While it does not have significant commercial applications, it plays a crucial role in the medicinal chemistry and pharmaceutical industry, being utilized for research and development and in drug synthesis.
Check Digit Verification of cas no
The CAS Registry Mumber 4733-65-7 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 4,7,3 and 3 respectively; the second part has 2 digits, 6 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 4733-65:
(6*4)+(5*7)+(4*3)+(3*3)+(2*6)+(1*5)=97
97 % 10 = 7
So 4733-65-7 is a valid CAS Registry Number.
InChI:InChI=1/C7H6N2O3/c8-6(10)4-2-1-3-9-5(4)7(11)12/h1-3H,(H2,8,10)(H,11,12)
