473681-77-5 Usage
General Description
1-(3,4-Dimethylphenyl)-4,5-dihydro-3-methyl-5-oxo-1H-pyrazole-4-carboxaldehyde is a chemical compound that falls under the broad category of organic compounds. Specifically, it belongs to the group of Pyrazoles, which are polycyclic aromatic compounds containing a five-membered ring with three carbon atoms, one nitrogen atom, and a ketone group. Its molecular formula is C14H16N2O2, indicating it consists of 14 carbon atoms, 16 hydrogen atoms, 2 nitrogen atoms, and 2 oxygen atoms. This chemical compound is mostly used for research purposes, especially in the field of organic chemistry. Due to its complex structure and functionalities, it can serve as a crucial intermediate for the synthesis of various other chemical compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 473681-77-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,7,3,6,8 and 1 respectively; the second part has 2 digits, 7 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 473681-77:
(8*4)+(7*7)+(6*3)+(5*6)+(4*8)+(3*1)+(2*7)+(1*7)=185
185 % 10 = 5
So 473681-77-5 is a valid CAS Registry Number.
InChI:InChI=1/C13H14N2O2/c1-8-4-5-11(6-9(8)2)15-13(17)12(7-16)10(3)14-15/h4-7,14H,1-3H3
