474021-97-1 Usage
General Description
(S)-N-(3-Bromo-2-acetoxypropyl)acetamide is a chemical compound with the molecular formula C6H10BrNO3. The compound is made up of a bromine atom, two acetoxypropyl groups, and an acetamide group. It is a derivative of acetamide and has a chiral center, giving it a specific stereochemistry. (S)-N-(3-Bromo-2-acetoxypropyl)acetamide may have potential applications in organic synthesis, pharmaceuticals, and biomedical research due to its unique structural features and potential reactivity. Its properties and potential uses may be further investigated in scientific studies.
Check Digit Verification of cas no
The CAS Registry Mumber 474021-97-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,7,4,0,2 and 1 respectively; the second part has 2 digits, 9 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 474021-97:
(8*4)+(7*7)+(6*4)+(5*0)+(4*2)+(3*1)+(2*9)+(1*7)=141
141 % 10 = 1
So 474021-97-1 is a valid CAS Registry Number.
InChI:InChI=1/C7H12BrNO3/c1-5(10)9-4-7(3-8)12-6(2)11/h7H,3-4H2,1-2H3,(H,9,10)/t7-/m1/s1