478829-34-4 Usage
General Description
1H-Indazole-5-carboxamide(9CI) is a chemical compound with the molecular formula C8H8N4O. It is a derivative of indazole, a heterocyclic aromatic organic compound. This chemical is commonly used in research and pharmaceutical settings as a building block for the synthesis of various heterocyclic compounds. It has potential applications in the development of drugs for various therapeutic purposes, including antimicrobial, antiviral, and anticancer agents. The compound has attracted interest for its ability to modulate certain biological pathways and cellular processes. Overall, 1H-Indazole-5-carboxamide(9CI) is a versatile chemical with diverse potential applications in medicinal chemistry and drug discovery.
Check Digit Verification of cas no
The CAS Registry Mumber 478829-34-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,7,8,8,2 and 9 respectively; the second part has 2 digits, 3 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 478829-34:
(8*4)+(7*7)+(6*8)+(5*8)+(4*2)+(3*9)+(2*3)+(1*4)=214
214 % 10 = 4
So 478829-34-4 is a valid CAS Registry Number.
InChI:InChI=1/C8H7N3O/c9-8(12)5-1-2-7-6(3-5)4-10-11-7/h1-4H,(H2,9,12)(H,10,11)