480424-49-5 Usage
Description
3-FORMYL-2-METHOXYBENZENEBORONIC ACID 98, also known as (3-Formyl-2-methoxyphenyl)boronic Acid, is a chemical compound that serves as a valuable synthetic intermediate in various chemical reactions. It is characterized by its unique chemical structure, which includes a formyl group and a methoxy group attached to a benzene ring, along with a boronic acid functional group. This structure endows it with versatile reactivity and makes it a promising candidate for use in the synthesis of various organic compounds.
Uses
Used in Pharmaceutical Industry:
3-FORMYL-2-METHOXYBENZENEBORONIC ACID 98 is used as a synthetic intermediate for the preparation of formyl-substituted aryl MIDA (N-Methyliminodiacetic Acid) boronates. These boronates are essential building blocks in the development of pharmaceutical compounds, particularly those targeting various diseases and medical conditions. The unique reactivity of 3-FORMYL-2-METHOXYBENZENEBORONIC ACID 98 allows for the efficient synthesis of these complex molecules, contributing to the advancement of drug discovery and development.
Used in Chemical Research:
In the field of chemical research, 3-FORMYL-2-METHOXYBENZENEBORONIC ACID 98 is used as a key intermediate in the synthesis of indolylamino phenylthienopyridine carbonitrile, a potent inhibitor of PKCθ (Protein Kinase C theta). PKCθ is a serine/threonine-specific protein kinase that plays a crucial role in various cellular processes, including cell proliferation, differentiation, and apoptosis. Inhibitors of PKCθ have been extensively studied for their potential therapeutic applications in treating various diseases, such as cancer, autoimmune disorders, and inflammatory conditions. The use of 3-FORMYL-2-METHOXYBENZENEBORONIC ACID 98 in the synthesis of these inhibitors highlights its importance in the development of novel therapeutic agents.
Check Digit Verification of cas no
The CAS Registry Mumber 480424-49-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,8,0,4,2 and 4 respectively; the second part has 2 digits, 4 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 480424-49:
(8*4)+(7*8)+(6*0)+(5*4)+(4*2)+(3*4)+(2*4)+(1*9)=145
145 % 10 = 5
So 480424-49-5 is a valid CAS Registry Number.
InChI:InChI=1/C8H9BO4/c1-13-8-6(5-10)3-2-4-7(8)9(11)12/h2-5,11-12H,1H3
