480424-62-2 Usage
Description
3,5-Diformylphenylboronic acid is an organic compound that features a phenyl ring with two formyl groups and a boronic acid functional group. It is known for its versatile chemical properties and reactivity, making it a valuable building block in various chemical and pharmaceutical applications.
Uses
Used in Pharmaceutical Industry:
3,5-Diformylphenylboronic acid is used as a key intermediate for the synthesis of various pharmaceutical compounds. Its ability to form stable complexes with biological molecules makes it a promising candidate for the development of new drugs.
Used in Chemical Research:
3,5-Diformylphenylboronic acid is used as a reactant in studies of surface-tension of enzyme inhibitors. Its unique structure allows it to interact with enzymes, providing insights into their function and potential inhibition.
Used in Organic Synthesis:
3,5-Diformylphenylboronic acid is used as a building block in the synthesis of bacteriochlorins. These complex organic molecules have potential applications in various fields, including medicine and materials science.
Used in Material Science:
3,5-Diformylphenylboronic acid is used in the synthesis of multicomponent assemblies of boron-based dendritic nanostructures. These nanostructures have potential applications in areas such as catalysis, drug delivery, and nanotechnology.
Used in Physical Chemistry:
3,5-Diformylphenylboronic acid is used in studies of the activation parameters for recombination reactions of intramolecular radical pairs. This helps researchers understand the underlying mechanisms of these reactions and their potential applications.
Used in Reactivity Studies:
3,5-Diformylphenylboronic acid is used in reactivity studies with diethanolamine. This provides valuable information on the compound's chemical behavior and its potential use in various applications.
Used in Organic Chemistry:
3,5-Diformylphenylboronic acid is used in regioselective 15-bromination and functionalization of bacteriochlorins. This allows for the selective modification of these complex molecules, enabling the development of new compounds with specific properties and applications.
Check Digit Verification of cas no
The CAS Registry Mumber 480424-62-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,8,0,4,2 and 4 respectively; the second part has 2 digits, 6 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 480424-62:
(8*4)+(7*8)+(6*0)+(5*4)+(4*2)+(3*4)+(2*6)+(1*2)=142
142 % 10 = 2
So 480424-62-2 is a valid CAS Registry Number.
InChI:InChI=1/C8H7BO4/c10-4-6-1-7(5-11)3-8(2-6)9(12)13/h1-5,12-13H
