480424-95-1 Usage
Description
N-(4-PHENYLBORONIC)SUCCINAMIC ACID is an organic compound that possesses unique chemical properties, making it a versatile molecule for various applications in different industries. It is characterized by its ability to form stable complexes with hydroxycoumarins and pyranocoumarins, which are known for their antitumor properties.
Uses
Used in Pharmaceutical Industry:
N-(4-PHENYLBORONIC)SUCCINAMIC ACID is used as a reactant for the construction of combinatorial artificial receptor arrays (CARA). These arrays are designed to mimic the function of natural receptors, allowing for the selective recognition and binding of specific target molecules, which can be useful in drug discovery and development.
Used in Chemical Synthesis:
N-(4-PHENYLBORONIC)SUCCINAMIC ACID is used as a reactant in the preparation of hydroxycoumarins and pyranocoumarins via Pechmann condensation and Pd-catalyzed Suzuki coupling. These compounds are known for their antitumor properties and can be used as potential therapeutic agents in the treatment of various types of cancer.
Used in Research and Development:
N-(4-PHENYLBORONIC)SUCCINAMIC ACID is also used in research and development for the synthesis of novel compounds with potential applications in various fields, such as pharmaceuticals, materials science, and chemical engineering. Its unique chemical properties make it a valuable tool for the development of new materials and technologies.
Check Digit Verification of cas no
The CAS Registry Mumber 480424-95-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,8,0,4,2 and 4 respectively; the second part has 2 digits, 9 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 480424-95:
(8*4)+(7*8)+(6*0)+(5*4)+(4*2)+(3*4)+(2*9)+(1*5)=151
151 % 10 = 1
So 480424-95-1 is a valid CAS Registry Number.
InChI:InChI=1/C10H12BNO5/c13-9(5-6-10(14)15)12-8-3-1-7(2-4-8)11(16)17/h1-4,16-17H,5-6H2,(H,12,13)(H,14,15)
