480438-54-8 Usage
Description
3-FLUORO-4-ISOPROPOXYPHENYLBORONIC ACID is an organic compound that serves as an essential intermediate in the synthesis of various pharmaceutical compounds. It is characterized by its fluoro and isopropoxy functional groups attached to a phenyl ring, which can be further modified through chemical reactions to produce a range of bioactive molecules.
Uses
Used in Pharmaceutical Industry:
3-FLUORO-4-ISOPROPOXYPHENYLBORONIC ACID is used as a key reactant for the synthesis of azaxanthene-based selective glucocorticoid receptor modulators. These modulators have potential applications in the treatment of various inflammatory and immune disorders, as they can selectively target the glucocorticoid receptor to modulate its activity.
3-FLUORO-4-ISOPROPOXYPHENYLBORONIC ACID is also used as a reactant in Suzuki and Stille coupling reactions for the synthesis of oral venous antithrombotic drugs. These drugs are designed to prevent blood clot formation in the veins, which can lead to potentially life-threatening conditions such as deep vein thrombosis and pulmonary embolism. The use of this boronic acid in these reactions allows for the efficient and selective formation of the desired antithrombotic compounds, contributing to the development of novel therapeutic agents for the treatment of venous thromboembolic disorders.
Check Digit Verification of cas no
The CAS Registry Mumber 480438-54-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,8,0,4,3 and 8 respectively; the second part has 2 digits, 5 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 480438-54:
(8*4)+(7*8)+(6*0)+(5*4)+(4*3)+(3*8)+(2*5)+(1*4)=158
158 % 10 = 8
So 480438-54-8 is a valid CAS Registry Number.
InChI:InChI=1/C9H12BFO3/c1-6(2)14-9-4-3-7(10(12)13)5-8(9)11/h3-6,12-13H,1-2H3
