480438-57-1 Usage
General Description
3-Chloro-4-propoxyphenylboronic acid is a chemical compound consisting of a boronic acid group attached to a phenyl ring with a chlorine atom and a propoxy side chain. It is commonly used in organic synthesis as a building block for creating various pharmaceuticals, agrochemicals, and other biologically active molecules. 3-Chloro-4-propoxyphenylboronic acid is also used as a reagent in Suzuki-Miyaura cross-coupling reactions and other organic transformations. Additionally, 3-Chloro-4-propoxyphenylboronic acid is known for its ability to form stable complexes with diols and other Lewis basic functional groups, making it useful in the development of sensors and other analytical applications.
Check Digit Verification of cas no
The CAS Registry Mumber 480438-57-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,8,0,4,3 and 8 respectively; the second part has 2 digits, 5 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 480438-57:
(8*4)+(7*8)+(6*0)+(5*4)+(4*3)+(3*8)+(2*5)+(1*7)=161
161 % 10 = 1
So 480438-57-1 is a valid CAS Registry Number.
InChI:InChI=1/C9H12BClO3/c1-2-5-14-9-4-3-7(10(12)13)6-8(9)11/h3-4,6,12-13H,2,5H2,1H3
