4812-29-7 Usage
General Description
3,6-Dimethyloctanoic acid is a naturally occurring organic compound with the molecular formula C10H20O2. It is classified as a fatty acid and is commonly found in various plant and animal sources. 3,6-DIMETHYLOCTANOIC ACID is known for its role in certain biological processes, including lipid metabolism and energy production. Additionally, 3,6-Dimethyloctanoic acid has been studied for its potential pharmaceutical and industrial applications, as well as its role in flavor and fragrance formulations. Overall, this chemical compound plays a significant role in various biological and industrial processes due to its unique chemical structure and properties.
Check Digit Verification of cas no
The CAS Registry Mumber 4812-29-7 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 4,8,1 and 2 respectively; the second part has 2 digits, 2 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 4812-29:
(6*4)+(5*8)+(4*1)+(3*2)+(2*2)+(1*9)=87
87 % 10 = 7
So 4812-29-7 is a valid CAS Registry Number.
InChI:InChI=1/C10H20O2/c1-4-8(2)5-6-9(3)7-10(11)12/h8-9H,4-7H2,1-3H3,(H,11,12)
