482-91-7 Usage
Description
ARICINE is a pyrrolizidine alkaloid derived from the plants Parsonia heterophylla A. Cun. and P. spiralis Wall. It is known for forming colorless needles when crystallized from C6H6.
Uses
Used in Pharmaceutical Industry:
ARICINE is used as a pharmaceutical compound for its potential therapeutic applications. Its alkaloid nature allows it to interact with various biological systems, making it a candidate for further research and development in the medical field.
Used in Chemical Research:
As a pyrrolizidine alkaloid, ARICINE is used in chemical research to study the properties and reactions of this class of compounds. This can contribute to the development of new drugs and chemical products with potential applications in various industries.
Used in Plant Biology:
ARICINE is used in plant biology to study the metabolic pathways and biosynthesis of alkaloids in plants. Understanding these processes can help in the development of more efficient methods for producing bioactive compounds and improving the medicinal properties of plants.
Check Digit Verification of cas no
The CAS Registry Mumber 482-91-7 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 4,8 and 2 respectively; the second part has 2 digits, 9 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 482-91:
(5*4)+(4*8)+(3*2)+(2*9)+(1*1)=77
77 % 10 = 7
So 482-91-7 is a valid CAS Registry Number.
InChI:InChI=1/C22H26N2O4/c1-12-17-10-24-7-6-15-14-5-4-13(26-2)8-19(14)23-21(15)20(24)9-16(17)18(11-28-12)22(25)27-3/h4-5,8,11-12,16-17,20,23H,6-7,9-10H2,1-3H3/t12-,16-,17-,20-/m0/s1