488-21-1 Usage
Description
Dimethylmaleic acid, also known as methylsuccinic acid, is a dicarboxylic acid derived from maleic acid with each hydrogen atom attached to a carbon atom substituted by a methyl group. It exhibits chemical properties typical of dicarboxylic acids and has potential applications in various industries due to its unique structure.
Uses
Used in Chemical Synthesis:
Dimethylmaleic acid is used as a key intermediate in the synthesis of various organic compounds, including pharmaceuticals, agrochemicals, and specialty chemicals. Its unique structure allows for versatile chemical reactions, making it a valuable building block in the development of new molecules.
Used in Polymer Industry:
In the polymer industry, dimethylmaleic acid is used as a monomer for the production of polymers with specific properties. Its dicarboxylic acid functionality can be polymerized to form polyesters, polyamides, or copolymers with tailored characteristics for various applications, such as coatings, adhesives, and plastics.
Used in Pharmaceutical Industry:
Dimethylmaleic acid is used as a pharmaceutical intermediate for the synthesis of drugs with diverse therapeutic applications. Its chemical reactivity and structural features enable the development of new drug candidates with improved efficacy and selectivity.
Used in Chiral Synthesis:
Due to its chiral nature, dimethylmaleic acid can be used in the synthesis of enantiomerically pure compounds, which are essential in the pharmaceutical industry for the development of chiral drugs with specific biological activities.
Used in Analytical Chemistry:
Dimethylmaleic acid can be employed as a chiral derivatizing agent in analytical chemistry for the resolution and analysis of enantiomers. Its ability to form diastereomers with different configurations can be utilized for the separation and detection of chiral compounds in various analytical techniques.
Check Digit Verification of cas no
The CAS Registry Mumber 488-21-1 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 4,8 and 8 respectively; the second part has 2 digits, 2 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 488-21:
(5*4)+(4*8)+(3*8)+(2*2)+(1*1)=81
81 % 10 = 1
So 488-21-1 is a valid CAS Registry Number.
InChI:InChI=1/C6H8O4/c1-3(5(7)8)4(2)6(9)10/h1-2H3,(H,7,8)(H,9,10)/b4-3-
488-21-1Relevant articles and documents
Synthesis and pH-dependent hydrolysis profiles of mono- and dialkyl substituted maleamic acids
Su, Shan,Du, Fu-Sheng,Li, Zi-Chen
supporting information, p. 8384 - 8392 (2017/10/19)
Maleamic acid derivatives as weakly acid-sensitive linkers or caging groups have been used widely in smart delivery systems. Here we report on the controlled synthetic methods to mono- and dialkyl substituted maleamic acids and their pH-dependent hydrolysis behaviors. Firstly, we studied the reaction between n-butylamine and citraconic anhydride, and found that the ratio of the two n-butyl citraconamic acid isomers (α and β) could be finely tuned by controlling the reaction temperature and time. Secondly, we investigated the effects of solvent, basic catalyst, and temperature on the reaction of n-butylamine with 2,3-dimethylmaleic anhydride, and optimized the reaction conditions to efficiently synthesize the dimethylmaleamic acids. Finally, we compared the pH-dependent hydrolysis profiles of four OEG-NH2 derived water-soluble maleamic acid derivatives. The results reveal that the number, structure, and position of the substituents on the cis-double bond exhibit a significant effect on the pH-related hydrolysis kinetics and selectivity of the maleamic acid derivatives. Interestingly, for the mono-substituted citraconamic acids (α-/β-isomer), we found that their hydrolyses are accompanied by the isomerization between the two isomers.
