4897-22-7 Usage
Description
5-CHLORO-1-ETHYL-2-METHYLIMIDAZOLE is an organic compound with the molecular formula C6H10ClN3. It is characterized by the presence of a chlorine atom at the 5th position, an ethyl group at the 1st position, and a methyl group at the 2nd position in the imidazole ring. 5-CHLORO-1-ETHYL-2-METHYLIMIDAZOLE is known for its potential applications in various fields due to its unique chemical structure and properties.
Uses
Used in Solar Cell Industry:
5-CHLORO-1-ETHYL-2-METHYLIMIDAZOLE is used as an additive for enhancing the performance of dye-sensitized TiO2 solar cells based on ionic liquid electrolyte. The application reason is that it can improve the efficiency and stability of the solar cells by modifying the properties of the electrolyte, leading to better energy conversion and overall performance.
Check Digit Verification of cas no
The CAS Registry Mumber 4897-22-7 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 4,8,9 and 7 respectively; the second part has 2 digits, 2 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 4897-22:
(6*4)+(5*8)+(4*9)+(3*7)+(2*2)+(1*2)=127
127 % 10 = 7
So 4897-22-7 is a valid CAS Registry Number.
InChI:InChI=1/C6H9ClN2/c1-3-9-5(2)8-4-6(9)7/h4H,3H2,1-2H3
