490-17-5 Usage
Description
Bis[2-(methoxycarbonyl)-8-methyl-8-azabicyclo[3.2.1]oct-3-yl] 2,4-diphenylcyclobutane-1,3-dicarboxylate, stereoisomer is a complex organic compound derived from the leaves of Erythroxylon truxillense Rusby. It is an amorphous white powder that is soluble in all organic solvents except light petroleum and is also insoluble in water. bis[2-(methoxycarbonyl)-8-methyl-8-azabicyclo[3.2.1]oct-3-yl] 2,4-diphenylcyclobutane-1,3-dicarboxylate, stereoisomer exhibits alllaevorotatory properties and has an intensely bitter taste. Acid hydrolysis with dilute HCl yields MeOH, (-)-ecgonine, and Q-truxillic acid, with a melting point of 228°C. The stereoisomer is synthesized by the action of α-truxillic anhydride on (-)-ecgonine, followed by methylation of the resulting α-truxilloylecgonine.
Uses
1. Used in Pharmaceutical Industry:
Bis[2-(methoxycarbonyl)-8-methyl-8-azabicyclo[3.2.1]oct-3-yl] 2,4-diphenylcyclobutane-1,3-dicarboxylate, stereoisomer is used as a pharmaceutical compound for its potential therapeutic applications. bis[2-(methoxycarbonyl)-8-methyl-8-azabicyclo[3.2.1]oct-3-yl] 2,4-diphenylcyclobutane-1,3-dicarboxylate, stereoisomer's unique structure and properties make it a promising candidate for the development of new drugs and therapies.
2. Used in Chemical Research:
This stereoisomer is also used in chemical research for studying the synthesis, properties, and potential applications of complex organic compounds. Its unique structure and properties can provide valuable insights into the behavior of similar compounds and contribute to the advancement of chemical science.
3. Used in Material Science:
Bis[2-(methoxycarbonyl)-8-methyl-8-azabicyclo[3.2.1]oct-3-yl] 2,4-diphenylcyclobutane-1,3-dicarboxylate, stereoisomer may have potential applications in material science due to its unique structural properties. It could be used in the development of new materials with specific characteristics, such as improved solubility, stability, or reactivity.
4. Used in Analytical Chemistry:
The stereoisomer can be employed in analytical chemistry for the development of new methods and techniques for the analysis and identification of complex organic compounds. Its unique properties can be utilized to improve the sensitivity, selectivity, and accuracy of analytical methods.
References
Hesse., Pharm. Zeit., 407,668 (1887)
Liebermann., Ber., 21,2342 (1888)
Hesse., ibid, 22, 665 (1889)
Liebermann, Drory., ibid, 22,682 (1889)
Check Digit Verification of cas no
The CAS Registry Mumber 490-17-5 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 4,9 and 0 respectively; the second part has 2 digits, 1 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 490-17:
(5*4)+(4*9)+(3*0)+(2*1)+(1*7)=65
65 % 10 = 5
So 490-17-5 is a valid CAS Registry Number.
InChI:InChI=1/C38H46N2O8/c1-39-23-15-17-25(39)31(35(41)45-3)27(19-23)47-37(43)33-29(21-11-7-5-8-12-21)34(30(33)22-13-9-6-10-14-22)38(44)48-28-20-24-16-18-26(40(24)2)32(28)36(42)46-4/h5-14,23-34H,15-20H2,1-4H3/t23-,24-,25+,26+,27-,28-,29?,30?,31+,32+,33?,34?/m0/s1