490028-21-2 Usage
Description
3-(Acetyloxy)-5-iodophenol-2’,3’,4’-tri-O-acetyl-β-D-glucuronide Methyl Ester is a white solid that serves as an intermediate in the synthesis of glucuronide conjugates of trans-Resveratrol. 3-(Acetyloxy)-5-iodophenol-2’,3’,4’-tri-O-acetyl-β-D-glucuronide Methyl Ester is characterized by its unique chemical structure, which includes an acetyloxy group, an iodine atom, and a β-D-glucuronide methyl ester moiety.
Uses
Used in Pharmaceutical Industry:
3-(Acetyloxy)-5-iodophenol-2’,3’,4’-tri-O-acetyl-β-D-glucuronide Methyl Ester is used as an intermediate for the synthesis of glucuronide conjugates of trans-Resveratrol. Trans-Resveratrol is a naturally occurring polyphenol with various pharmacological properties, including antioxidant, anti-inflammatory, and anti-cancer activities. The glucuronide conjugates of trans-Resveratrol are formed to improve its solubility, bioavailability, and stability, which are essential for its pharmaceutical applications.
Used in Research and Development:
3-(Acetyloxy)-5-iodophenol-2’,3’,4’-tri-O-acetyl-β-D-glucuronide Methyl Ester is also used in research and development for the study of glucuronidation, a crucial metabolic pathway in the body. 3-(Acetyloxy)-5-iodophenol-2’,3’,4’-tri-O-acetyl-β-D-glucuronide Methyl Ester can be utilized to investigate the role of glucuronidation in drug metabolism, detoxification, and the development of new drugs with improved pharmacokinetic properties.
Used in Chemical Synthesis:
As a white solid with unique chemical properties, 3-(Acetyloxy)-5-iodophenol-2’,3’,4’-tri-O-acetyl-β-D-glucuronide Methyl Ester can be employed in various chemical synthesis processes. Its versatile structure allows for further functionalization and modification, making it a valuable building block for the development of new compounds with potential applications in various industries, such as pharmaceuticals, agrochemicals, and materials science.
Check Digit Verification of cas no
The CAS Registry Mumber 490028-21-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,9,0,0,2 and 8 respectively; the second part has 2 digits, 2 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 490028-21:
(8*4)+(7*9)+(6*0)+(5*0)+(4*2)+(3*8)+(2*2)+(1*1)=132
132 % 10 = 2
So 490028-21-2 is a valid CAS Registry Number.
InChI:InChI=1/C21H23IO12/c1-9(23)29-14-6-13(22)7-15(8-14)33-21-19(32-12(4)26)17(31-11(3)25)16(30-10(2)24)18(34-21)20(27)28-5/h6-8,16-19,21H,1-5H3/t16-,17-,18?,19-,21+/m1/s1