4919-09-9 Usage
General Description
6-methyl-[1,2,4]triazolo[4,3-a]pyridine, also known as 6-Me-1,2,4-triazolo[4,3-a]pyridine, is a chemical compound with the molecular formula C7H6N4. It is a heterocyclic organic compound that is commonly used in the pharmaceutical industry as a building block for the synthesis of various pharmaceutical drugs. Its unique structure and properties make it a valuable starting material for the production of a range of bioactive compounds. Additionally, it has shown potential as an antifungal agent and has been the subject of research for its potential therapeutic applications. Its diverse applications and structural versatility make it an important compound in the field of medicinal chemistry and drug development.
Check Digit Verification of cas no
The CAS Registry Mumber 4919-09-9 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 4,9,1 and 9 respectively; the second part has 2 digits, 0 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 4919-09:
(6*4)+(5*9)+(4*1)+(3*9)+(2*0)+(1*9)=109
109 % 10 = 9
So 4919-09-9 is a valid CAS Registry Number.
InChI:InChI=1/C7H7N3/c1-6-2-3-7-9-8-5-10(7)4-6/h2-5H,1H3
